Mebendazole D3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-10955 |
| Alternative Name(s) | NULL |
| Research Area | Labeled Mebendazole, intended for use as an internal standard for the quantification of Mebendazole by GC- or LC-mass spectrometry. |
| Molecular Formula | C16D3H10N3O3 |
| CAS# | 1173021-87-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(C1=CC=CC=C1)C2=CC=C3C(NC(NC(OC([2H])([2H])[2H])=O)=N3)=C2 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10955.html |
| Additional Information | NULL |