Indole Acetic Acid D7
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-14433 |
| Alternative Name(s) | Indole-2,4,5,6,7-d5-3-acetic-2,2-d2 Acid;Indole-2,4,5,6,7-D5-3-acetic-2,2-D2 Acid;2-[(2,4,5,6,7-D5)-1H-indol-3-yl](D2)acetic acid. |
| Research Area | Labeled Indole Acetic Acid, intended for use as an internal standard for the quantification of Indole Acetic Acid by GC- or LC-mass spectrometry. |
| Molecular Formula | C10H2D7NO2 |
| CAS# | 1173020-21-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(C([2H])([2H])C(C(C1=C2[2H])=C(C([2H])=C2[2H])[2H])=C(N1)[2H])=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO14433.html |
| Additional Information | NULL |