Cyclizine D3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02640 |
| Alternative Name(s) | 1-(diphenylmethyl)-4-(D3)methylpiperazine |
| Research Area | Labeled Cyclizine, intended for use as an internal standard for the quantification of Cyclizine by GC- or LC-mass spectrometry. |
| Molecular Formula | C18H22N2 |
| CAS# | 1170155-67-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | [2H]C([2H])([2H])N1CCN(CC1)C(C2=CC=CC=C2)C3=CC=CC=C3 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02640.html |
| Additional Information | NULL |