Diatrizoic acid (Standard) | MedChemExpress (MCE)
Diatrizoic acid (Standard) is the analytical standard of Diatrizoic acid. This product is intended for research and analytical applications. Diatrizoic acid (Diatrizoate) is an iodinated radiocontrast agent and has the potential for radiographic imaging of the airways. Diatrizoic acid induces mitochondrial turnover and oxidative stress, and activating apoptosis by dysregulating calcium[1][2].
| Trivial name | Diatrizoic acid (Standard) |
| Catalog Number | HY-B0926R |
| Alternative Name(s) | Diatrizoate (Standard); Amidotrizoic acid (Standard) |
| Research Area | Inflammation/Immunology |
| CAS# | 117-96-4 |
| Purity | ≥98.0% |
| SMILES | O=C(O)C1=C(I)C(NC(C)=O)=C(I)C(NC(C)=O)=C1I |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/diatrizoic-acid-standard.html |