Diphenylacetic acid | MedChemExpress (MCE)
Diphenylacetic acid (Diphenylmethane-α-carboxylic Acid) is a biochemical reagent that can be used as a biological material or organic compound for life science related research[1].
| Trivial name | Diphenylacetic acid |
| Catalog Number | HY-Y0549 |
| Alternative Name(s) | Diphenylmethane-α-carboxylic Acid |
| Research Area | Others |
| CAS# | 117-34-0 |
| Purity | ≥98.0% |
| SMILES | O=C(O)C(C1=CC=CC=C1)C2=CC=CC=C2 |
| Size | 25 g |
| Supplier Page | https://www.medchemexpress.com/diphenylacetic-acid.html |