Magnoloside B | MedChemExpress (MCE)
Magnoloside B is an α-glucosidase inhibitor (IC50=0.69 mM), which can be obtained from Magnolia officinalis stem bark. Magnoloside B shows moderate inhibitory activity against MGC-803 and HepG2 cells. Magnoloside B has the potential to study cancer and diabetes[1].
| Trivial name | Magnoloside B |
| Catalog Number | HY-126535 |
| Research Area | Metabolic Disease; Cancer |
| CAS# | 116872-05-0 |
| Purity | ≥98.00% |
| SMILES | O[C@H]([C@@H](CO[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1)O2)[C@@H](OC(/C=C/C3=CC=C(O)C(O)=C3)=O)[C@@H](O[C@H]4[C@@H]([C@@H]([C@H]([C@H](C)O4)O)O)O)[C@@H]2OCCC5=CC=C(O)C(O)=C5 |
| PubChem Chemical Structure ID | 21629880 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/magnoloside-b.html |