SGPL1 fluorogenic substrate | MedChemExpress (MCE)
SGPL1 fluorogenic substrate is the fluorogenic substrate of sphingosine-1-phosphate lyase (SGPL1) that can be used to measure the activity of SGPL1[1].
| Trivial name | SGPL1 fluorogenic substrate |
| Catalog Number | HY-D2284 |
| Alternative Name(s) | Sphingosine-1-phosphate lyase fluorogenic substrate |
| Research Area | Cancer |
| CAS# | 1166838-84-1 |
| Purity | ≥98.0% |
| SMILES | O=P(O)(O)OC[C@H](N)[C@H](O)CCOC1=CC=C(C=CC(O2)=O)C2=C1 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/sgpl1-fluorogenic-substrate.html |