(15R)-Bimatoprost | MedChemExpress (MCE)
(15R)-Bimatoprost (15(R)-17-phenyl trinor PGF2α ethyl amide) is a prostaglandin analog used to treat glaucoma and ocular hypertension. (15R)-Bimatoprost is an isomer of Bimatoprost with an inverted (β) hydroxyl group on C-15[1].
| Trivial name | (15R)-Bimatoprost |
| Catalog Number | HY-114867 |
| Alternative Name(s) | 15(R)-17-phenyl trinor PGF2α ethyl amide |
| Research Area | Endocrinology |
| CAS# | 1163135-92-9 |
| Purity | ≥98.0% |
| SMILES | CCNC(CCC/C=C\C[C@H]1[C@@H](O)C[C@@H](O)[C@@H]1/C=C/[C@H](O)CCC2=CC=CC=C2)=O |
| Size | 500 μg |
| Supplier Page | https://www.medchemexpress.com/15r-bimatoprost.html |