Kemptide, 5-FAM labeled | MedChemExpress (MCE)
Kemptide, 5-FAM labeled is a biological active peptide. (Kemptide is a phosphate acceptor peptide that serves as a synthetic substrate for PKA (Km = 16 μM). The corresponding fluorescent and biotinylated peptides are also proven to be good substrates for PKA. 5-FAM labeled HY-P0248)
| Trivial name | Kemptide, 5-FAM labeled |
| Catalog Number | HY-P0248F |
| Research Area | Others |
| CAS# | 1161072-61-2 |
| Purity | ≥98.00% |
| SMILES | O=C([C@@H](NC(C1=CC=C2C(C(OC23C4=CC=C(O)C=C4OC5=CC(O)=CC=C53)=O)=C1)=O)CC(C)C)N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(NCC(O)=O)=O)CC(C)C)=O)CO)=O)C)=O)CCCNC(N)=N)=O)CCCNC(N)=N |
| PubChem Chemical Structure ID | 168510650 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/kemptide-5-fam-labeled.html |