Memantine Lactose Adduct
Intermediates
| Trivial name | NULL |
| Catalog Number | CS-T-57472 |
| Alternative Name(s) | NULL |
| Research Area | A lactose adduct of Memantine . Intermediate in the synthesis of reducing carbohydrate Adamantane amines for use in treating Gram positive or Gram negative bacteria infections. |
| Molecular Formula | NULL |
| CAS# | 1159637-28-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@H]([C@@H](O)[C@@H]1O[C@]([C@@H]([C@@H](O)[C@@H]2O)O)([H])O[C@@H]2CO)C(O[C@@H]1CO)N[C@](C[C@](C)(C3)C4)(C[C@@H]3C5)C[C@]45C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST57472.html |
| Additional Information | NULL |