[4-(4-phenylpiperazin-1-yl)oxan-4-yl]methanamine
[4-(4-phenylpiperazin-1-yl)oxan-4-yl]methanamine is a piperazine derivative that is a partial agonist at serotonin and dopamine receptors, making it a candidate for the treatment of psychiatric disorders such as depression and schizophrenia.
| Catalog Number | T50061 |
| Research Area | Others |
| Molecular Formula | C16H25N3O |
| CAS# | 1157013-41-6 |
| Purity | 95.00% |
| SMILES | NCC1(CCOCC1)N1CCN(CC1)c1ccccc1 |
| Size | 1 mg |
| Supplier Page | https://www.targetmol.com/compound/_4-(4-phenylpiperazin-1-yl)oxan-4-yl_methanamine |
| Additional Information | https://www.targetmol.com/datasheet/T50061 |
