Hydroxy Ipronidazole D3
Marine
| Trivial name | NULL |
| Catalog Number | CS-W-00169 |
| Alternative Name(s) | NULL |
| Research Area | The labelled metabolite of Ipronidazole . ;Labeled Ipronidazole, intended for use as an internal standard for the quantification of Ipronidazole by GC- or LC-mass spectrometry. |
| Molecular Formula | C7H8D3N3O3 |
| CAS# | 1156508-86-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC(C)(O)C1=NC=C([N](=O)=O)N1C([2H])([2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSW00169.html |
| Additional Information | NULL |