Tetramethylrhodamine Methyl Ester Perchlorate
TMRM Perchlorate is a red fluorescent dye with cell-permeant cationic lipophilic (λex and λem are 530 nm, 592 nm, respectively).
| Trivial name | TMRM Perchlorate; TMRM |
| Catalog Number | CSN21857 |
| Alternative Name(s) | TMRM Perchlorate; TMRM |
| Research Area | / |
| Molecular Formula | C25H25ClN2O7 |
| CAS# | 115532-50-8 |
| Purity | ≥98% |
| SMILES | O=C(C1=CC=CC=C1C2=C3C=CC(N(C)C)=CC3=[O+]C4=C2C=CC(N(C)C)=C4)OC.O=Cl(=O)([O-])=O |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/tetramethylrhodamine-methyl-ester-perchlorate.html |