Dofetilide 10mM * 1mL in DMSO
Dofetilide is a class III antiarrhythmic agent. Dofetilide works by selectively blocking the rapid component of the delayed rectifier outward potassium current (Ikr).
| Trivial name | Dofetilide 10mM * 1mL in DMSO |
| Catalog Number | A10328-10mM-D |
| Alternative Name(s) | N-[4-(2-{[2-(4-methane sulfonamidophenoxy)ethyl] (methyl)amino}ethyl)phenyl]methanesulfonamide |
| Molecular Formula | C19H27N3O5S2 |
| CAS# | 115256-11-6 |
| SMILES | CN(CCC1=CC=C(C=C1)NS(=O)(=O)C)CCOC2=CC=C(C=C2)NS(=O)(=O)C |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/dofetilide.html |
