VX-661 10mM * 1mL in DMSO
VX-661 is another cystic fibrosis transmembrane conductance regulator (CFTR) corrector in development for the treatment of cystic fibrosis.
| Trivial name | VX-661 10mM * 1mL in DMSO |
| Catalog Number | A12519-10mM-D |
| Alternative Name(s) | N/A |
| Molecular Formula | C26H27F3N2O6 |
| CAS# | 1152311-62-0 |
| SMILES | CC(C)(CO)C1=CC2=CC(=C(C=C2N1C[C@H](CO)O)F)NC(=O)C3(CC3)C4=CC5=C(C=C4)OC(O5)(F)F |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/vx-661.html |
