Lesinurad sodium
Lesinurad (Selexipag, RDEA-594) sodium (Zurampic) is a selective uric acid reabsorption inhibitor (SURI) under investigation for treatment of gout. Lesinurad sodium inhibits the uric acid transporter URAT1 and Kidney transporter OAT with IC50/Km of 4.3 μM/0.85 μM and 3.5 μM/2 μM for OAT1 and OAT3, respectively.
| Trivial name | Selexipag, Zurampic, RDEA-594 sodium |
| Catalog Number | S5189 |
| Molecular Formula | C17H13BrN3NaO2S |
| CAS# | 1151516-14-1 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | [Na+].[O-]C(=O)CSC1=NN=C(Br)[N]1C2=CC=C(C3CC3)C4=CC=CC=C24 |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/lesinurad-sodium.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s5189-lesinurad-sodium-chemical-structure.gif |