Tiagabine
API Standards
| Trivial name | NULL |
| Catalog Number | CS-O-02469 |
| Alternative Name(s) | (R)-1-(4,4-bis(3-methylthiophen-2-yl)but-3-en-1-yl)piperidine-3-carboxylic acid |
| Research Area | Tiagabine is an anti-convulsive medication. It is also used in the treatment for panic disorder as are a few other anticonvulsants. Though the exact mechanism by which tiagabine exerts its effect on the human body is unknown, it does appear to operate as |
| Molecular Formula | C20H25NO2S2 |
| CAS# | 115103-54-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC1=C(SC=C1)/C(C(SC=C2)=C2C)=C/CCN(CCC3)C[C@@H]3C(O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02469.html |
| Additional Information | NULL |