Docetaxel (Taxotere) 10mM * 1mL in DMSO
Docetaxel (Taxotere) is an antineoplastic agent that acts by disrupting the microtubular network in cells that is essential for mitotic and interphase cellular functions.
Trivial name | Docetaxel (Taxotere) 10mM * 1mL in DMSO |
Catalog Number | A10326-10mM-D |
Alternative Name(s) | 1,7??,10??-trihydroxy-9-oxo-5??,20-epoxytax-11-ene-2??,4,13??-triyl 4-acetate 2-benzoate 13-{(2R,3S)-3-[(tert-butoxycarbonyl)amino]-2-hydroxy-3-phenylpropanoate} |
Molecular Formula | C43H53NO14 |
CAS# | 114977-28-5 |
SMILES | CC1=C2[C@H](C(=O)[C@@]3([C@H](C[C@@H]4[C@]([C@H]3[C@@H]([C@@](C2(C)C)(C[C@@H]1OC(=O)[C@@H]([C@H](C5=CC=CC=C5)NC(=O)OC(C)(C)C)O)O)OC(=O)C6=CC=CC=C6)(CO4)OC(=O)C)O)C)O |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/docetaxel-taxotere.html |