XL-888 10mM * 1mL in DMSO
XL888 is an orally bioavailable, ATP-competitive, small-molecule inhibitor of heat shock protein 90 (Hsp90) with potential antineoplastic activity.
| Trivial name | XL-888 10mM * 1mL in DMSO |
| Catalog Number | A11251-10mM-D |
| Alternative Name(s) | 5-((R)-sec-butylamino)-N1-((1R,3s,5S)-8-(5-(cyclopropanecarbonyl)pyridin-2-yl)-8-azabicyclo[3.2.1]octan-3-yl)-2-methylterephthalamide |
| Molecular Formula | C29H37N5O3 |
| CAS# | 1149705-71-4 |
| SMILES | CCC(C)NC1=CC(=C(C=C1C(=O)N)C)C(=O)NC2C[C@H]3CC[C@@H](C2)N3C4=NC=C(C=C4)C(=O)C5CC5 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/xl-888.html |
