Z-L-Val-OH | MedChemExpress (MCE)
Z-L-Val-OH is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
| Trivial name | Z-L-Val-OH |
| Catalog Number | HY-W008753 |
| Alternative Name(s) | N-Cbz-L-valine |
| Research Area | Others |
| CAS# | 1149-26-4 |
| Purity | ≥98.00% |
| SMILES | CC(C)[C@@H](C(O)=O)NC(OCC1=CC=CC=C1)=O |
| PubChem Chemical Structure ID | 726987 |
| Size | 25 g |
| Supplier Page | https://www.medchemexpress.com/z-l-val-oh.html |