Lorcaserin Hydrochloride D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-T-57298 |
| Alternative Name(s) | (1R)l-1H-3-benzazepine-d4 HyChloro-1-methyl-2,3,4,5-tetrahydro-1H-3-benzazepine-d4 Hydrochloride; (R)-8-Chloro-1-methyl-2,3,4,5-tetrahydro-1H-benzo[d]azepine-d4 Hydrochloride; APD 356-d4; |
| Research Area | Lorcaserin hydrochloride is a highly selective 5-HT2C receptor agonist developed for the treatment of obesity. Labeled Lorcaserin, intended for use as an internal standard for the quantification of Lorcaserin by GC- or LC-mass spectrometry. |
| Molecular Formula | NULL |
| CAS# | 1146440-33-6 (Free base) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@H]1C2=CC(Cl)=CC=C2CC([2H])([2H])NC1([2H])[2H].Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST57298.html |
| Additional Information | NULL |