ARRY-543 10mg
ARRY-543 is a novel, oral ErbB family inhibitor that, unlike approved ErbB inhibitors, targets all members of the ErbB family, including ErbB3, either directly or indirectly, and has potential advantages in treating tumors that signal through multiple ErbB family members.
| Trivial name | ARRY-543 10mg |
| Catalog Number | A12868-10 |
| Alternative Name(s) | N/A |
| Molecular Formula | N/A |
| CAS# | 114629-86-8 |
| SMILES | ClC1=CC(NC2=NC=NC3=CC=C(NC4=N[C@H](C)CO4)C=C32)=CC=C1OCC5=NC=CS5.CC6=CC=C(S(O)=O)C=C6.CC7=CC=C(S(O)=O)C=C7 |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/arry-543.html |
