(R)-MDE
API Standards
| Trivial name | NULL |
| Catalog Number | CS-O-02268 |
| Alternative Name(s) | (RMDE) R(-)ethyl [diphenylmethyl)sulphenyl]acetate;UNII-PVK7G754HO; PVK7G754HO; SCHEMBL896903; Mde, (-)-; (R)-Methylenedioxyethylamphetamine; L-3,4-methylenedioxyethylamphetamine; (2R)-1-(1,3-benzodioxol-5-yl)-N-ethylpropan-2-amine |
| Research Area | R-MDE is a psychoactive drug of the phenethylamine and amphetamine classes of drugs. It is consumed primarily for its euphoric and empathogenic effects. |
| Molecular Formula | NULL |
| CAS# | 114612-27-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@H](NCC)CC1=CC(OCO2)=C2C=C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02268.html |
| Additional Information | NULL |