(+)-U-50488 hydrochloride
(+)-U-50488 hydrochloride is the less active enantiomer of (±)-U-50488, which is an opioid receptor agonist.
| Catalog Number | 114528-81-3 |
| Alternative Name(s) | (±)-U-50488 hydrochloride; (±)-U 50488 hydrochloride; (±)-U50488 hydrochloride; trans-(+)-3,4-Dichloro-N-methyl-N-[2-(1-pyrrolidinyl)-cyclohexyl]benzeneacetamide hydrochloride; (+)-trans-(1R,2R)-U-50488 hydrochloride |
| Molecular Formula | C19H26Cl2N2O.HCl |
| CAS# | 114528-81-3 |
| Purity | ≥99% |
| Inchi | InChI=1S/C19H26Cl2N2O.ClH/c1-22(19(24)13-14-8-9-15(20)16(21)12-14)17-6-2-3-7-18(17)23-10-4-5-11-23;/h8-9,12,17-18H,2-7,10-11,13H2,1H3;1H/t17-,18-;/m1./s1 |
| Inchi Key | KGMMGVIYOHGOKQ-JAXOOIEVSA-N |
| Size | Please inquire |
| Supplier Page | https://www.bocsci.com/u-50488-hydrochloride-cas-114528-81-3-item-170526.html |
