Urolithin A
Urolithin A is a metabolite of ellagitannin with antiproliferative and antioxidant properties. It can cross the blood brain barrier, and may have neuroprotective effects against Alzheimer’s Disease.
| Trivial name | Urolithin-A |
| Catalog Number | CSN20492 |
| Alternative Name(s) | Urolithin-A |
| Research Area | / |
| Molecular Formula | C13H8O4 |
| CAS# | 1143-70-0 |
| Purity | ≥99% |
| SMILES | O=C1C2=CC(O)=CC=C2C3=C(O1)C=C(O)C=C3 |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/urolithin-a.html |
