2,6-Naphthalenedicarboxylic acid
Self-assembly of 2,6-naphthalenedicarboxylic acid into two-dimensionally ordered supramolecular structures was studied at the liquid-solid interface by scanning tunneling microscopy. Solvothermal reaction of Mn(II) and 2,6-naphthalenedicarboxylic acid in diethylformamide to form a 3D porous metal-organic framework generating 1D channels was studied.
| Catalog Number | CBB1113355 |
| Molecular Formula | C10H6(CO2H)2 |
| CAS# | 1141-38-4 |
| Purity | >95% |
| Inchi | 1S/C12H8O4/c13-11(14)9-3-1-7-5-10(12(15)16)4-2-8(7)6-9/h1-6H,(H,13,14)(H,15,16) |
| Inchi Key | RXOHFPCZGPKIRD-UHFFFAOYSA-N |
| SMILES | OC(=O)c1ccc2cc(ccc2c1)C(O)=O |
| Size | Inquiry |
| Supplier Page | https://www.amerigoscientific.com/26-naphthalenedicarboxylic-acid-item-113355.html |