Cabozantinib Malate
A multi-tyrosine kinase inhibitor, used for the treatment of progressive, metastatic, medullary thyroid cancer. It has a role as a tyrosine kinase inhibitor, an antineoplastic agent and a prodrug.
| Catalog Number | API1140909483 |
| Alternative Name(s) | Cabozantinib S-malate cabozantinib (S)-malate Cabometyx |
| Research Area | Anti-Tumor APIs |
| Molecular Formula | C32H30FN3O10 |
| CAS# | 1140909-48-3 |
| SMILES | COC1=CC2=C(C=CN=C2C=C1OC)OC3=CC=C(C=C3)NC(=O)C4(CC4)C(=O)NC5=CC=C(C=C5)F.C(C(C(=O)O)O)C(=O)O |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/cabozantinib-malate-item-12490.html |