Obidoxime Chloride
API Standard
| Catalog Number | CS-O-30710 |
| Alternative Name(s) | 1,1’[Oxybis(methylene)]-bis[4-(hydroxyimino)methyl]pyridinium Dchloride; Toxogonin Dchloride; Toxogonine; Toxobidin; Toksobidin |
| Research Area | Obidoxime is a member of the oxime family used to treat nerve gas poisoning. Oximes are drugs known for their ability to reverse the binding of organophosphorus compounds to the enzyme acetylcholinesterase (AChE). Oximes such as obidoxime, pralidoxime and |
| Molecular Formula | C14H1Cl2N4O3 |
| CAS# | 114-90-9 |
| Purity | >98% |
| SMILES | O=[NH+]/C=C1C=CN(COCN2C=C/C(C=C2)=C[NH+]=O)C=C/1.[Cl-].[Cl-] |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30710.html |