Propoxur
Agro Chemicals
| Trivial name | NULL |
| Catalog Number | CS-T-40717 |
| Alternative Name(s) | 2-(propan-2-yloxy)phenyl N-methylcarbamate |
| Research Area | Propoxur is a non-systematic carbamate insecticide. Propoxur is used against a wide range of insects such as fleas, mosquitoes, ants, gypsy moths, and other agricultural pests. Propoxur functions by reversibly inactivating the enzyme acetylcholinesterase in insects. |
| Molecular Formula | C11H15NO3 |
| CAS# | 114-26-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(NC)OC(C=CC=C1)=C1OC(C)C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST40717.html |
| Additional Information | NULL |