Erythromycin
Erythromycin is an antibiotic used for the treatment of a number of bacterial infections, used for the treatment of a number of bacterial infections.
| Trivial name | E-Mycin; Erythrocin; Abomacetin; Erythromycin-A |
| Catalog Number | CSN12503 |
| Alternative Name(s) | E-Mycin; Erythrocin; Abomacetin; Erythromycin-A |
| Research Area | Infection |
| Molecular Formula | C37H67NO13 |
| CAS# | 114-07-8 |
| Purity | ≥98% |
| SMILES | CC[C@@H]1[C@@]([C@@H]([C@H](C(=O)[C@@H](C[C@@]([C@@H]([C@H]([C@@H]([C@H](C(=O)O1)C)O[C@H]2C[C@@]([C@H]([C@@H](O2)C)O)(C)OC)C)O[C@H]3[C@@H]([C@H](C[C@H](O3)C)N(C)C)O)(C)O)C)C)O)(C)O |
| Size | 5g |
| Supplier Page | https://www.csnpharm.com/products/erythromycin.html |