PNU 74654
Wnt signaling pathway inhibitor Stem Cell|Wnt/β-catenin
| Catalog Number | B7422-25 |
| Research Area | Stem Cell|Wnt/β-catenin |
| Molecular Formula | C19H16N2O3 |
| CAS# | 113906-27-7 |
| Purity | 98% |
| SMILES | O=C(C1=CC=CC=C1OC2=CC=CC=C2)N/N=C/C3=CC=C(C)O3 |
| Size | 25mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B7422 |
