Urolithin B
Urolithin B inhibits NF-κB activity by reducing the phosphorylation and degradation of IκBα. Urolithin B suppresses the phosphorylation of JNK, ERK, and Akt, and enhances the phosphorylation of AMPK. Urolithin B is also a regulator of skeletal muscle mass.
Trivial name | N/A |
Catalog Number | S1321 |
Molecular Formula | C13H8O3 |
CAS# | 1139-83-9 |
SMILES | OC1=CC2=C(C=C1)C3=CC=CC=C3C(=O)O2 |
Size | 5mg |
Supplier Page | http://www.selleckchem.com/products/urolithin-b.html |
Additional Information | https://file.selleck.cn/downloads/struct/s1321-urolithin-b-chemical-structure.gif |