Cis (2,3)-Dihydro Tetrabenazine
A metabolite of Tetrabenazine in vivo, which is likely the active pharmacological agent. The cis izomer of Dihydrotetrabenazine is used for the treatment of hyperkinetic movement disorders.
| Catalog Number | CS-T-18962 |
| Alternative Name(s) | Cis (2,3)-Dihydro Tetrabenazine;Beta Hydroxy Tetrabenazine;(2R,3S,11bS)-rel-1,3,4,6,7,11b-Hexahydro-9,10-dimethoxy-3-(2-methylpropyl)-2H-benzo[a]quinolizin-2-ol;(2R,3S,11bS)-rel-1,3,4,6,7,11b-Hexahydro-9,10-dimethoxy-3-(2-methylpropyl)-2H-benzo[a]quinolizin-2-ol ; CS-A-00301 |
| Research Area | Metabolites |
| Molecular Formula | C19H29NO3 |
| CAS# | 113627-25-1 |
| Purity | >98% |
| SMILES | COC(C=C1[C@@]2([H])N3C[C@H](CC(C)C)[C@H](O)C2)=C(C=C1CC3)OC |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST18962.html |