m-Nisoldipine | MedChemExpress (MCE)
m-Nisoldipine (KR-1008) is a dihydropyridine calcium antagonist that can significantly increase cardiac output and heart index, significantly reduce the negative inotropic effect on the myocardium, and has a relatively high selectivity for the thoracic aorta. m-Nisoldipine can be used in the research of cardiovascular diseases[1].
| Trivial name | m-Nisoldipine |
| Catalog Number | HY-W184837 |
| Alternative Name(s) | KR-1008 |
| Research Area | Cardiovascular Disease |
| CAS# | 113578-26-0 |
| Purity | ≥98.0% |
| SMILES | O=C(C1=C(C)NC(C)=C(C(OCC(C)C)=O)C1C2=CC=CC([N+]([O-])=O)=C2)OC |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/m-nisoldipine.html |