Baclofen
Baclofen is a synthetic chlorophenyl-butanoic acid derivative used to treat spasms due to spinal cord damage and multiple sclerosis, muscle-relaxing Baclofen acts as a gamma-aminobutyric acid (GABA) agonist specific for GABA-B receptors. It acts at spinal and supraspinal sites, reducing excitatory transmission.
| Catalog Number | T1065 |
| Alternative Name(s) | Lioresal |
| Research Area | Neuroscience|||Membrane transporter/Ion channel |
| Molecular Formula | C10H12ClNO2 |
| CAS# | 1134-47-0 |
| Purity | 99.68% |
| SMILES | NCC(CC(O)=O)C1=CC=C(Cl)C=C1 |
| Size | 200 mg |
| Supplier Page | https://www.targetmol.com/compound/Baclofen |
| Additional Information | https://www.targetmol.com/datasheet/T1065 |
