Letrozole D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06716 |
| Alternative Name(s) | NULL |
| Research Area | Labeled Letrozole, intended for use as an internal standard for the quantification of Letrozole by GC- or LC-mass spectrometry. |
| Molecular Formula | C17H7D4N5 |
| CAS# | 1133712-96-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | N#CC1=C([2H])C([2H])=C(C([2H])=C1[2H])C(N2C=NC=N2)C3=CC=C(C#N)C=C3 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06716.html |
| Additional Information | NULL |