Deferasirox D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02863 |
| Alternative Name(s) | 4-[3,5-bis(2-hydroxyphenyl)-1H-1,2,4-triazol-1-yl](D4)benzoic acid |
| Research Area | Labelled orally active tridentate iron chelator.;Labeled Deferasirox, intended for use as an internal standard for the quantification of Deferasirox by GC- or LC-mass spectrometry. |
| Molecular Formula | C21H11D4N3O4 |
| CAS# | 1133425-75-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(C=CC=C1)=C1C2=NC(C(C=CC=C3)=C3O)=NN2C(C([2H])=C4[2H])=C(C([2H])=C4C(O)=O)[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02863.html |
| Additional Information | NULL |