Alfuzosin D7
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-10083 |
| Alternative Name(s) | N-[3-[(4-amino-6,7-dimethoxy-2-quinazolinyl) methylamino]propyl]tetrahydro-2-Furan-D7-carboxamide |
| Research Area | Labeled Alfuzosin, intended for use as an internal standard for the quantification of Alfuzosin by GC- or LC-mass spectrometry. |
| Molecular Formula | C19H20D7N5O4 |
| CAS# | 1133386-93-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | NC1=NC(N(C)CCCNC(C2([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])O2)=O)=NC3=C1C=C(OC)C(OC)=C3 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10083.html |
| Additional Information | NULL |