Nicorandil D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-11953 |
| Alternative Name(s) | Perisalol-d4;N-[2-(Nitrooxy)ethyl]-3-pyridinecarboxamide-d4;2-{[(D4)-3-Pyridinylcarbonyl]amino}ethyl nitrate |
| Research Area | Labeled Nicorandil, intended for use as an internal standard for the quantification of Nicorandil by GC- or LC-mass spectrometry. |
| Molecular Formula | C8H5D4N3O4 |
| CAS# | 1132681-23-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(C(C([2H])=C1[2H])=C(N=C1[2H])[2H])NCCO[N](=O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11953.html |
| Additional Information | NULL |