Glimepiride D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02884 |
| Alternative Name(s) | 3-ethyl-4-methyl-2-oxo-N-(2-{4-[({[(1r,4r)-4-methylcyclohexyl]carbamoyl}amino)sulfonyl]phenyl}(1,1,2,2-D4)ethyl)-2,5-dihydro-1H-pyrrole-1-carboxamide |
| Research Area | Labeled Glimepiride, intended for use as an internal standard for the quantification of Glimepiride by GC- or LC-mass spectrometry. |
| Molecular Formula | C24H30D4N4O5S |
| CAS# | 1131981-29-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(N(CC(C)=C1CC)C1=O)NC([2H])([2H])C([2H])([2H])C2=CC=C([S](NC(N[C@H]3CC[C@H](C)CC3)=O)(=O)=O)C=C2 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02884.html |
| Additional Information | NULL |