Lamotrigine isethionate | MedChemExpress (MCE)
Lamotrigine (BW430C) isethionate is a potent and orally active anticonvulsant or antiepileptic agent. Lamotrigine isethionate selectively blocks voltage-gated Na+ channels, stabilizing presynaptic neuronal membranes and inhibiting glutamate release. Lamotrigine isethionate can be used for the research of epilepsy, focal seizure, et al[1][2].
| Trivial name | Lamotrigine isethionate |
| Catalog Number | HY-110032 |
| Alternative Name(s) | LTG isethionate; BW430C isethionate |
| Research Area | Neurological Disease; Cancer |
| CAS# | 113170-86-8 |
| Purity | ≥98.00% |
| SMILES | O=S(O)(CCO)=O.ClC1=C(Cl)C(C2=C(N)N=C(N)N=N2)=CC=C1 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/lamotrigine-isethionate.html |