Ciprofloxacin D8
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02802 |
| Alternative Name(s) | 1-cyclopropyl-6-fluoro-4-oxo-7-(piperazin-1-yl)-quinoline-3-carboxylic acid; 1-cyclopropyl-6-fluoro-4-oxo-7-[(2,2,3,3,5,5,6,6- D8)piperazin-1-yl]-1,4-dihydroquinoline-3- carboxylic acid |
| Research Area | A labelled fluorinated quinolone antibacterial.;Labeled Ciprofloxacin, intended for use as an internal standard for the quantification of Ciprofloxacin by GC- or LC-mass spectrometry. |
| Molecular Formula | C17H10D8FN3O3 |
| CAS# | 1130050-35-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C1C2=CC(F)=C(N3C([2H])([2H])C([2H])([2H])NC([2H])([2H])C3([2H])[2H])C=C2N(C4CC4)C=C1C(O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02802.html |
| Additional Information | NULL |