Chlorpheniramine maleate 10mM * 1mL in DMSO
Chlorpheniramine maleate is a first-generation alkylamine antihistamine used in the prevention of the symptoms of allergic conditions such as rhinitis and urticaria.
| Trivial name | Chlorpheniramine maleate 10mM * 1mL in DMSO |
| Catalog Number | A10205-10mM-D |
| Alternative Name(s) | 2-(p-Chloro-alpha-(2-(dimethylamino)ethyl)benzyl)-pyridinmaleate |
| Molecular Formula | C16H19ClN2.C4H4O4 |
| CAS# | 113-92-8 |
| SMILES | CN(C)CCC(C1=CC=C(C=C1)Cl)C2=CC=CC=N2.C(=CC(=O)O)C(=O)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/chlorpheniramine-maleate.html |