Calcipotriol D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-11360 |
| Alternative Name(s) | Calcipotriene-d4;Daivonex D4;Calcipotriene D4, Daivonex D4, Psorcutan D4, Sorilux D4, Dovonex D4, |
| Research Area | Labeled Calcipotriol, Intended for use as an internal standard for the quantification of Calcipotriol by GC- or LC-mass spectrometry |
| Molecular Formula | C27H36D4O3 |
| CAS# | 112965-21-6 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@]([C@@]1([H])[C@H](C)/C=C/[C@H](C2C([2H])([2H])C2([2H])[2H])O)(CCC/3)[C@](CC1)([H])C3=CC=C(C[C@@H](O)C[C@@H]4O)/C4=C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11360.html |
| Additional Information | NULL |