PD128907 HCl
Potent and selective dopamine D3 receptor agonist Neuroscience|Dopamine Receptor
| Catalog Number | B1491-10 |
| Research Area | Neuroscience|Dopamine Receptor |
| Molecular Formula | C14H19NO3.HCl |
| CAS# | 112960-16-4 |
| Purity | 98% |
| SMILES | CCCN1CCOC2C1COC3=C2C=C(C=C3)O.Cl |
| Size | 10mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B1491 |
