Pemetrexed D5 disodium salt
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-03070 |
| Alternative Name(s) | N-[4-[2-(2-amino-4,7-dihydro-4-oxo-1H-pyrrolo[2,3-d]pyrimidin-5-yl)ethyl]benzoyl]-L-glut |
| Research Area | Labeled Pemetrexed, intended for use as an internal standard for the quantification of Pemetrexed by GC- or LC-mass spectrometry. |
| Molecular Formula | C20H14D5N5Na2O6 |
| CAS# | 1129408-57-6 (Freebase) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C1C2=C(NC(N)=N1)NC=C2CCC3=CC=C(C(N[C@@](C([O-])=O)([2H])C([2H])([2H])C([2H])([2H])C([O-])=O)=O)C=C3.[Na+].[Na+] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO03070.html |
| Additional Information | NULL |