(+)-Osbeckic acid | MedChemExpress (MCE)
(+)-Osbeckic acid is a vasorelaxatant that can be isolated from Tartary Buckwheat. (+)-Osbeckic acid has a potent vasorelaxant effect in Sprague-Dawley rat thoracic aorta rings with an EC50 of 887 μM[1].
| Trivial name | (+)-Osbeckic acid |
| Catalog Number | HY-N11925 |
| Research Area | Cardiovascular Disease |
| CAS# | 112923-64-5 |
| Purity | ≥98.00% |
| SMILES | OC([C@H](C1=CC=C(C(O)=O)O1)O)=O |
| PubChem Chemical Structure ID | 13965144 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/plus-osbeckic-acid.html |