Raltitrexed (Tomudex) 10mM * 1mL in DMSO
Raltitrexed (Tomudex) is an inhibitor of thymidylate synthase and also is one of the strongest antimetabolites in use.
| Trivial name | Raltitrexed (Tomudex) 10mM * 1mL in DMSO |
| Catalog Number | A10776-10mM-D |
| Alternative Name(s) | N-[(5-{methyl[(2-methyl-4-oxo-1,4-dihydroquinazolin-6-yl)methyl]amino}-2-thienyl)carbonyl]-L-glutamic acid |
| Molecular Formula | C21H22N4O6S |
| CAS# | 112887-68-0 |
| SMILES | CC1=NC(=O)C2=C(N1)C=CC(=C2)CN(C)C3=CC=C(S3)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/raltitrexed-tomudex.html |
