Gatifloxacin
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-11656 |
| Alternative Name(s) | 1methoxy-7-(3-methyl-1-piperazinyl)-4-oxo-3-quinolinecarboxylic Acid |
| Research Area | Gatifloxacin is an antibiotic of the fourth-generation fluoroquinolone family. |
| Molecular Formula | C19H22FN3O4 |
| CAS# | 112811-59-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | COC(C(N(CCN1)CC1C)=C(F)C=C23)=C2N(C4CC4)C=C(C(O)=O)C3=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11656.html |
| Additional Information | NULL |