IWR-1-endo 25mg
IWR-1-endo is a potent inhibitor of the Wnt response, blocking a cell-based Wnt/??-catenin pathway reporter response with an IC50 value of 180 nM. Wnt proteins bind to receptors on the cell surface, initiating a signaling cascade that leads to ??-catenin activation of gene transcription.
Trivial name | IWR-1-endo 25mg |
Catalog Number | A12737-25 |
Alternative Name(s) | [(3aR*,4S*,7R*,7aS)-1,3,3a,4,7,7a-H?exahydro-1,3-dioxo-4,7-methano-2H-isoindol-2-yl]-N?-8-quinolinylbenzamide |
Molecular Formula | C25H19N3O3 |
CAS# | 1127442-82-3 |
SMILES | C1C2C=CC1C3C2C(=O)N(C3=O)C4=CC=C(C=C4)C(=O)NC5=CC=CC6=C5N=CC=C6 |
Size | 25mg |
Supplier Page | http://www.adooq.com/iwr-1-endo.html |